C19H21ClN4O2 — CID 91771159
5-chloro-N-[(3-hydroxycyclobutyl)-(1-methylpyrazol-4-yl)methyl]-3-methyl-1H-indole-2-carboxamide (PubChem CID 91771159) has the molecular formula C19H21ClN4O2 and a molecular weight of 372.86 g/mol. Its IUPAC name is 5-chloro-N-[(3-hydroxycyclobutyl)-(1-methylpyrazol-4-yl)methyl]-3-methyl-1H-indole-2-carboxamide.
| Compound Name | 5-chloro-N-[(3-hydroxycyclobutyl)-(1-methylpyrazol-4-yl)methyl]-3-methyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 91771159 |
| Molecular Formula | C19H21ClN4O2 |
| Molecular Weight | 372.86 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | 5-chloro-N-[(3-hydroxycyclobutyl)-(1-methylpyrazol-4-yl)methyl]-3-methyl-1H-indole-2-carboxamide |
| SMILES | Cc1c(C(=O)NC(c2cnn(C)c2)C2CC(O)C2)[nH]c2ccc(Cl)cc12 |
| InChI | InChI=1S/C19H21ClN4O2/c1-10-15-7-13(20)3-4-16(15)22-17(10)19(26)23-18(11-5-14(25)6-11)12-8-21-24(2)9-12/h3-4,7-9,11,14,18,22,25H,5-6H2,1-2H3,(H,23,26) |
| InChIKey | KXHDBIYPQIRYJQ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 82.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.86 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|