C16H18ClN3O3 — CID 91795698
3-chloro-4-hydroxy-N-[(3-hydroxycyclobutyl)-(1-methylpyrazol-4-yl)methyl]benzamide (PubChem CID 91795698) has the molecular formula C16H18ClN3O3 and a molecular weight of 335.79 g/mol. Its IUPAC name is 3-chloro-4-hydroxy-N-[(3-hydroxycyclobutyl)-(1-methylpyrazol-4-yl)methyl]benzamide.
| Compound Name | 3-chloro-4-hydroxy-N-[(3-hydroxycyclobutyl)-(1-methylpyrazol-4-yl)methyl]benzamide |
|---|---|
| PubChem CID | 91795698 |
| Molecular Formula | C16H18ClN3O3 |
| Molecular Weight | 335.79 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | 3-chloro-4-hydroxy-N-[(3-hydroxycyclobutyl)-(1-methylpyrazol-4-yl)methyl]benzamide |
| SMILES | Cn1cc(C(NC(=O)c2ccc(O)c(Cl)c2)C2CC(O)C2)cn1 |
| InChI | InChI=1S/C16H18ClN3O3/c1-20-8-11(7-18-20)15(10-4-12(21)5-10)19-16(23)9-2-3-14(22)13(17)6-9/h2-3,6-8,10,12,15,21-22H,4-5H2,1H3,(H,19,23) |
| InChIKey | YOYLHWVCPDPFIW-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.79 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |