C18H19N5O3 — CID 91762120
N-[(3-hydroxycyclobutyl)-(1-methylpyrazol-4-yl)methyl]-3-oxo-4H-quinoxaline-2-carboxamide (PubChem CID 91762120) has the molecular formula C18H19N5O3 and a molecular weight of 353.38 g/mol. Its IUPAC name is N-[(3-hydroxycyclobutyl)-(1-methylpyrazol-4-yl)methyl]-3-oxo-4H-quinoxaline-2-carboxamide.
| Compound Name | N-[(3-hydroxycyclobutyl)-(1-methylpyrazol-4-yl)methyl]-3-oxo-4H-quinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 91762120 |
| Molecular Formula | C18H19N5O3 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | N-[(3-hydroxycyclobutyl)-(1-methylpyrazol-4-yl)methyl]-3-oxo-4H-quinoxaline-2-carboxamide |
| SMILES | Cn1cc(C(NC(=O)c2nc3ccccc3[nH]c2=O)C2CC(O)C2)cn1 |
| InChI | InChI=1S/C18H19N5O3/c1-23-9-11(8-19-23)15(10-6-12(24)7-10)22-18(26)16-17(25)21-14-5-3-2-4-13(14)20-16/h2-5,8-10,12,15,24H,6-7H2,1H3,(H,21,25)(H,22,26) |
| InChIKey | OXHRUVGHNSUMTF-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 112.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |