C12H13ClN2O3 — CID 84743045
3-(2-aminoethyl)-6-chloro-5-methoxy-1H-indole-2-carboxylic acid (PubChem CID 84743045) has the molecular formula C12H13ClN2O3 and a molecular weight of 268.70 g/mol. Its IUPAC name is 3-(2-aminoethyl)-6-chloro-5-methoxy-1H-indole-2-carboxylic acid.
| Compound Name | 3-(2-aminoethyl)-6-chloro-5-methoxy-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 84743045 |
| Molecular Formula | C12H13ClN2O3 |
| Molecular Weight | 268.70 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | 3-(2-aminoethyl)-6-chloro-5-methoxy-1H-indole-2-carboxylic acid |
| SMILES | COc1cc2c(CCN)c(C(=O)O)[nH]c2cc1Cl |
| InChI | InChI=1S/C12H13ClN2O3/c1-18-10-4-7-6(2-3-14)11(12(16)17)15-9(7)5-8(10)13/h4-5,15H,2-3,14H2,1H3,(H,16,17) |
| InChIKey | ZLWPEEZRAYQSEX-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 88.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.70 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|