C12H12ClNO3 — CID 90083235
6-chloro-3-(3-hydroxypropyl)-1H-indole-2-carboxylic acid (PubChem CID 90083235) has the molecular formula C12H12ClNO3 and a molecular weight of 253.68 g/mol. Its IUPAC name is 6-chloro-3-(3-hydroxypropyl)-1H-indole-2-carboxylic acid.
| Compound Name | 6-chloro-3-(3-hydroxypropyl)-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 90083235 |
| Molecular Formula | C12H12ClNO3 |
| Molecular Weight | 253.68 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | 6-chloro-3-(3-hydroxypropyl)-1H-indole-2-carboxylic acid |
| SMILES | O=C(O)c1[nH]c2cc(Cl)ccc2c1CCCO |
| InChI | InChI=1S/C12H12ClNO3/c13-7-3-4-8-9(2-1-5-15)11(12(16)17)14-10(8)6-7/h3-4,6,14-15H,1-2,5H2,(H,16,17) |
| InChIKey | KMCFKGFGQOUQMH-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.68 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|