C10H6ClNO4 — CID 115043325
7-chloro-3-hydroxy-4-oxo-1H-quinoline-2-carboxylic acid (PubChem CID 115043325) has the molecular formula C10H6ClNO4 and a molecular weight of 239.61 g/mol. Its IUPAC name is 7-chloro-3-hydroxy-4-oxo-1H-quinoline-2-carboxylic acid.
| Compound Name | 7-chloro-3-hydroxy-4-oxo-1H-quinoline-2-carboxylic acid |
|---|---|
| PubChem CID | 115043325 |
| Molecular Formula | C10H6ClNO4 |
| Molecular Weight | 239.61 g/mol |
| Exact Mass | 239.00 |
| IUPAC Name | 7-chloro-3-hydroxy-4-oxo-1H-quinoline-2-carboxylic acid |
| SMILES | O=C(O)c1[nH]c2cc(Cl)ccc2c(=O)c1O |
| InChI | InChI=1S/C10H6ClNO4/c11-4-1-2-5-6(3-4)12-7(10(15)16)9(14)8(5)13/h1-3,14H,(H,12,13)(H,15,16) |
| InChIKey | SYVDUKJQUHPHGH-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.61 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |