C10H8ClNO4S — CID 54689450
7-chloro-4-hydroxy-3-methylsulfonyl-1H-quinolin-2-one (PubChem CID 54689450) has the molecular formula C10H8ClNO4S and a molecular weight of 273.70 g/mol. Its IUPAC name is 7-chloro-4-hydroxy-3-methylsulfonyl-1H-quinolin-2-one.
| Compound Name | 7-chloro-4-hydroxy-3-methylsulfonyl-1H-quinolin-2-one |
|---|---|
| PubChem CID | 54689450 |
| Molecular Formula | C10H8ClNO4S |
| Molecular Weight | 273.70 g/mol |
| Exact Mass | 272.99 |
| IUPAC Name | 7-chloro-4-hydroxy-3-methylsulfonyl-1H-quinolin-2-one |
| SMILES | CS(=O)(=O)c1c(O)c2ccc(Cl)cc2[nH]c1=O |
| InChI | InChI=1S/C10H8ClNO4S/c1-17(15,16)9-8(13)6-3-2-5(11)4-7(6)12-10(9)14/h2-4H,1H3,(H2,12,13,14) |
| InChIKey | JEFMADZMKSSBTD-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 87.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.70 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |