C16H10ClNO4 — CID 54732078
3-(1,3-benzodioxol-5-yl)-7-chloro-4-hydroxy-1H-quinolin-2-one (PubChem CID 54732078) has the molecular formula C16H10ClNO4 and a molecular weight of 315.71 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-7-chloro-4-hydroxy-1H-quinolin-2-one.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-7-chloro-4-hydroxy-1H-quinolin-2-one |
|---|---|
| PubChem CID | 54732078 |
| Molecular Formula | C16H10ClNO4 |
| Molecular Weight | 315.71 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-7-chloro-4-hydroxy-1H-quinolin-2-one |
| SMILES | O=c1[nH]c2cc(Cl)ccc2c(O)c1-c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H10ClNO4/c17-9-2-3-10-11(6-9)18-16(20)14(15(10)19)8-1-4-12-13(5-8)22-7-21-12/h1-6H,7H2,(H2,18,19,20) |
| InChIKey | PDXKTYWOPRNNBO-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 71.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.71 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |