C11H10ClNO5S — CID 134910353
6-chloro-4-hydroxy-7-methoxy-3-methylsulfonyl-1H-quinolin-2-one (PubChem CID 134910353) has the molecular formula C11H10ClNO5S and a molecular weight of 303.72 g/mol. Its IUPAC name is 6-chloro-4-hydroxy-7-methoxy-3-methylsulfonyl-1H-quinolin-2-one.
| Compound Name | 6-chloro-4-hydroxy-7-methoxy-3-methylsulfonyl-1H-quinolin-2-one |
|---|---|
| PubChem CID | 134910353 |
| Molecular Formula | C11H10ClNO5S |
| Molecular Weight | 303.72 g/mol |
| Exact Mass | 303.00 |
| IUPAC Name | 6-chloro-4-hydroxy-7-methoxy-3-methylsulfonyl-1H-quinolin-2-one |
| SMILES | COc1cc2[nH]c(=O)c(S(C)(=O)=O)c(O)c2cc1Cl |
| InChI | InChI=1S/C11H10ClNO5S/c1-18-8-4-7-5(3-6(8)12)9(14)10(11(15)13-7)19(2,16)17/h3-4H,1-2H3,(H2,13,14,15) |
| InChIKey | KJDQMWBEYKSVMD-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 96.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.72 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |