C12H12ClN2O2 — CID 154597526
CID 154597526 (PubChem CID 154597526) has the molecular formula C12H12ClN2O2 and a molecular weight of 251.69 g/mol.
| Compound Name | CID 154597526 |
|---|---|
| PubChem CID | 154597526 |
| Molecular Formula | C12H12ClN2O2 |
| Molecular Weight | 251.69 g/mol |
| Exact Mass | 251.06 |
| IUPAC Name | — |
| SMILES | COc1cc2[nH]c(=O)c([C@H](C)[NH])cc2cc1Cl |
| InChI | InChI=1S/C12H12ClN2O2/c1-6(14)8-3-7-4-9(13)11(17-2)5-10(7)15-12(8)16/h3-6,14H,1-2H3,(H,15,16)/t6-/m0/s1 |
| InChIKey | VOIWQQFFLMNVEK-LURJTMIESA-N |
| XLogP | 2.53 |
| TPSA | 65.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.69 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |