C20H19ClN6O2 — CID 135378403
6-chloro-7-methoxy-3-[1-[3-(5-methyltetrazol-1-yl)anilino]ethyl]-1H-quinolin-2-one (PubChem CID 135378403) has the molecular formula C20H19ClN6O2 and a molecular weight of 410.87 g/mol. Its IUPAC name is 6-chloro-7-methoxy-3-[1-[3-(5-methyltetrazol-1-yl)anilino]ethyl]-1H-quinolin-2-one.
| Compound Name | 6-chloro-7-methoxy-3-[1-[3-(5-methyltetrazol-1-yl)anilino]ethyl]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 135378403 |
| Molecular Formula | C20H19ClN6O2 |
| Molecular Weight | 410.87 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | 6-chloro-7-methoxy-3-[1-[3-(5-methyltetrazol-1-yl)anilino]ethyl]-1H-quinolin-2-one |
| SMILES | COc1cc2[nH]c(=O)c(C(C)Nc3cccc(-n4nnnc4C)c3)cc2cc1Cl |
| InChI | InChI=1S/C20H19ClN6O2/c1-11(22-14-5-4-6-15(9-14)27-12(2)24-25-26-27)16-7-13-8-17(21)19(29-3)10-18(13)23-20(16)28/h4-11,22H,1-3H3,(H,23,28) |
| InChIKey | CZZKWGBVUIZBKW-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 97.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.87 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |