C15H20NO4S+ — CID 139820562
(4-hydroxy-6,7-dimethoxy-2-oxo-1H-quinolin-3-yl)-methyl-propylsulfanium (PubChem CID 139820562) has the molecular formula C15H20NO4S+ and a molecular weight of 310.40 g/mol. Its IUPAC name is (4-hydroxy-6,7-dimethoxy-2-oxo-1H-quinolin-3-yl)-methyl-propylsulfanium.
| Compound Name | (4-hydroxy-6,7-dimethoxy-2-oxo-1H-quinolin-3-yl)-methyl-propylsulfanium |
|---|---|
| PubChem CID | 139820562 |
| Molecular Formula | C15H20NO4S+ |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | (4-hydroxy-6,7-dimethoxy-2-oxo-1H-quinolin-3-yl)-methyl-propylsulfanium |
| SMILES | CCC[S+](C)c1c(O)c2cc(OC)c(OC)cc2[nH]c1=O |
| InChI | InChI=1S/C15H19NO4S/c1-5-6-21(4)14-13(17)9-7-11(19-2)12(20-3)8-10(9)16-15(14)18/h7-8H,5-6H2,1-4H3,(H-,16,17,18)/p+1 |
| InChIKey | ATWRLICKVFRSFY-UHFFFAOYSA-O |
| XLogP | 2.27 |
| TPSA | 71.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|