C17H24N3O5+ — CID 54675903
3-[(4-hydroxy-6,7-dimethoxy-2-oxo-1H-quinoline-3-carbonyl)amino]propyl-dimethylazanium (PubChem CID 54675903) has the molecular formula C17H24N3O5+ and a molecular weight of 350.40 g/mol. Its IUPAC name is 3-[(4-hydroxy-6,7-dimethoxy-2-oxo-1H-quinoline-3-carbonyl)amino]propyl-dimethylazanium.
| Compound Name | 3-[(4-hydroxy-6,7-dimethoxy-2-oxo-1H-quinoline-3-carbonyl)amino]propyl-dimethylazanium |
|---|---|
| PubChem CID | 54675903 |
| Molecular Formula | C17H24N3O5+ |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 3-[(4-hydroxy-6,7-dimethoxy-2-oxo-1H-quinoline-3-carbonyl)amino]propyl-dimethylazanium |
| SMILES | COc1cc2[nH]c(=O)c(C(=O)NCCC[NH+](C)C)c(O)c2cc1OC |
| InChI | InChI=1S/C17H23N3O5/c1-20(2)7-5-6-18-16(22)14-15(21)10-8-12(24-3)13(25-4)9-11(10)19-17(14)23/h8-9H,5-7H2,1-4H3,(H,18,22)(H2,19,21,23)/p+1 |
| InChIKey | MYKBNHGMAHPDPY-UHFFFAOYSA-O |
| XLogP | -0.48 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|