C23H24N2O7 — CID 54682431
butyl 4-[(4-hydroxy-6,7-dimethoxy-2-oxo-1H-quinoline-3-carbonyl)amino]benzoate (PubChem CID 54682431) has the molecular formula C23H24N2O7 and a molecular weight of 440.45 g/mol. Its IUPAC name is butyl 4-[(4-hydroxy-6,7-dimethoxy-2-oxo-1H-quinoline-3-carbonyl)amino]benzoate.
| Compound Name | butyl 4-[(4-hydroxy-6,7-dimethoxy-2-oxo-1H-quinoline-3-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 54682431 |
| Molecular Formula | C23H24N2O7 |
| Molecular Weight | 440.45 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | butyl 4-[(4-hydroxy-6,7-dimethoxy-2-oxo-1H-quinoline-3-carbonyl)amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)c2c(O)c3cc(OC)c(OC)cc3[nH]c2=O)cc1 |
| InChI | InChI=1S/C23H24N2O7/c1-4-5-10-32-23(29)13-6-8-14(9-7-13)24-21(27)19-20(26)15-11-17(30-2)18(31-3)12-16(15)25-22(19)28/h6-9,11-12H,4-5,10H2,1-3H3,(H,24,27)(H2,25,26,28) |
| InChIKey | CRLYFAUTIKDGFR-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 126.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.45 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|