C25H28N2O4 — CID 58024544
N-(4-hexoxyphenyl)-4-hydroxy-2-oxo-6-prop-2-enyl-1H-quinoline-3-carboxamide (PubChem CID 58024544) has the molecular formula C25H28N2O4 and a molecular weight of 420.51 g/mol. Its IUPAC name is N-(4-hexoxyphenyl)-4-hydroxy-2-oxo-6-prop-2-enyl-1H-quinoline-3-carboxamide.
| Compound Name | N-(4-hexoxyphenyl)-4-hydroxy-2-oxo-6-prop-2-enyl-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 58024544 |
| Molecular Formula | C25H28N2O4 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | N-(4-hexoxyphenyl)-4-hydroxy-2-oxo-6-prop-2-enyl-1H-quinoline-3-carboxamide |
| SMILES | C=CCc1ccc2[nH]c(=O)c(C(=O)Nc3ccc(OCCCCCC)cc3)c(O)c2c1 |
| InChI | InChI=1S/C25H28N2O4/c1-3-5-6-7-15-31-19-12-10-18(11-13-19)26-24(29)22-23(28)20-16-17(8-4-2)9-14-21(20)27-25(22)30/h4,9-14,16H,2-3,5-8,15H2,1H3,(H,26,29)(H2,27,28,30) |
| InChIKey | BDNCNISNSXGFHA-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|