C19H26N3O5+ — CID 54693303
2-[(4-hydroxy-6,7-dimethoxy-2-oxo-1-prop-2-enylquinoline-3-carbonyl)amino]ethyl-dimethylazanium (PubChem CID 54693303) has the molecular formula C19H26N3O5+ and a molecular weight of 376.43 g/mol. Its IUPAC name is 2-[(4-hydroxy-6,7-dimethoxy-2-oxo-1-prop-2-enylquinoline-3-carbonyl)amino]ethyl-dimethylazanium.
| Compound Name | 2-[(4-hydroxy-6,7-dimethoxy-2-oxo-1-prop-2-enylquinoline-3-carbonyl)amino]ethyl-dimethylazanium |
|---|---|
| PubChem CID | 54693303 |
| Molecular Formula | C19H26N3O5+ |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | 2-[(4-hydroxy-6,7-dimethoxy-2-oxo-1-prop-2-enylquinoline-3-carbonyl)amino]ethyl-dimethylazanium |
| SMILES | C=CCn1c(=O)c(C(=O)NCC[NH+](C)C)c(O)c2cc(OC)c(OC)cc21 |
| InChI | InChI=1S/C19H25N3O5/c1-6-8-22-13-11-15(27-5)14(26-4)10-12(13)17(23)16(19(22)25)18(24)20-7-9-21(2)3/h6,10-11,23H,1,7-9H2,2-5H3,(H,20,24)/p+1 |
| InChIKey | MLPOPNJXTRZFDU-UHFFFAOYSA-O |
| XLogP | -0.22 |
| TPSA | 94.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|