C24H26N2O7 — CID 71506124
N-[(3,4-dimethoxyphenyl)methyl]-4-hydroxy-6,7-dimethoxy-2-oxo-1-prop-2-enylquinoline-3-carboxamide (PubChem CID 71506124) has the molecular formula C24H26N2O7 and a molecular weight of 454.48 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)methyl]-4-hydroxy-6,7-dimethoxy-2-oxo-1-prop-2-enylquinoline-3-carboxamide.
| Compound Name | N-[(3,4-dimethoxyphenyl)methyl]-4-hydroxy-6,7-dimethoxy-2-oxo-1-prop-2-enylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 71506124 |
| Molecular Formula | C24H26N2O7 |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)methyl]-4-hydroxy-6,7-dimethoxy-2-oxo-1-prop-2-enylquinoline-3-carboxamide |
| SMILES | C=CCn1c(=O)c(C(=O)NCc2ccc(OC)c(OC)c2)c(O)c2cc(OC)c(OC)cc21 |
| InChI | InChI=1S/C24H26N2O7/c1-6-9-26-16-12-20(33-5)19(32-4)11-15(16)22(27)21(24(26)29)23(28)25-13-14-7-8-17(30-2)18(10-14)31-3/h6-8,10-12,27H,1,9,13H2,2-5H3,(H,25,28) |
| InChIKey | RIQBUFPURSPDII-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 108.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|