C22H29N3O5 — CID 54693300
N-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]-4-hydroxy-6,7-dimethoxy-2-oxo-1-prop-2-enylquinoline-3-carboxamide (PubChem CID 54693300) has the molecular formula C22H29N3O5 and a molecular weight of 415.49 g/mol. Its IUPAC name is N-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]-4-hydroxy-6,7-dimethoxy-2-oxo-1-prop-2-enylquinoline-3-carboxamide.
| Compound Name | N-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]-4-hydroxy-6,7-dimethoxy-2-oxo-1-prop-2-enylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 54693300 |
| Molecular Formula | C22H29N3O5 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | N-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]-4-hydroxy-6,7-dimethoxy-2-oxo-1-prop-2-enylquinoline-3-carboxamide |
| SMILES | C=CCn1c(=O)c(C(=O)NC[C@@H]2CCCN2CC)c(O)c2cc(OC)c(OC)cc21 |
| InChI | InChI=1S/C22H29N3O5/c1-5-9-25-16-12-18(30-4)17(29-3)11-15(16)20(26)19(22(25)28)21(27)23-13-14-8-7-10-24(14)6-2/h5,11-12,14,26H,1,6-10,13H2,2-4H3,(H,23,27)/t14-/m0/s1 |
| InChIKey | WFLQHZCLARWZPG-AWEZNQCLSA-N |
| XLogP | 2.12 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|