C18H20N2O5 — CID 54679671
N-cyclopropyl-4-hydroxy-6,7-dimethoxy-2-oxo-1-prop-2-enylquinoline-3-carboxamide (PubChem CID 54679671) has the molecular formula C18H20N2O5 and a molecular weight of 344.37 g/mol. Its IUPAC name is N-cyclopropyl-4-hydroxy-6,7-dimethoxy-2-oxo-1-prop-2-enylquinoline-3-carboxamide.
| Compound Name | N-cyclopropyl-4-hydroxy-6,7-dimethoxy-2-oxo-1-prop-2-enylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 54679671 |
| Molecular Formula | C18H20N2O5 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | N-cyclopropyl-4-hydroxy-6,7-dimethoxy-2-oxo-1-prop-2-enylquinoline-3-carboxamide |
| SMILES | C=CCn1c(=O)c(C(=O)NC2CC2)c(O)c2cc(OC)c(OC)cc21 |
| InChI | InChI=1S/C18H20N2O5/c1-4-7-20-12-9-14(25-3)13(24-2)8-11(12)16(21)15(18(20)23)17(22)19-10-5-6-10/h4,8-10,21H,1,5-7H2,2-3H3,(H,19,22) |
| InChIKey | JJAGKKKEVZVSRD-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|