C16H24BrN3O3 — CID 14076876
2-amino-3-bromo-N-[(1-ethylpyrrolidin-2-yl)methyl]-5,6-dimethoxybenzamide (PubChem CID 14076876) has the molecular formula C16H24BrN3O3 and a molecular weight of 386.29 g/mol. Its IUPAC name is 2-amino-3-bromo-N-[(1-ethylpyrrolidin-2-yl)methyl]-5,6-dimethoxybenzamide.
| Compound Name | 2-amino-3-bromo-N-[(1-ethylpyrrolidin-2-yl)methyl]-5,6-dimethoxybenzamide |
|---|---|
| PubChem CID | 14076876 |
| Molecular Formula | C16H24BrN3O3 |
| Molecular Weight | 386.29 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | 2-amino-3-bromo-N-[(1-ethylpyrrolidin-2-yl)methyl]-5,6-dimethoxybenzamide |
| SMILES | CCN1CCCC1CNC(=O)c1c(N)c(Br)cc(OC)c1OC |
| InChI | InChI=1S/C16H24BrN3O3/c1-4-20-7-5-6-10(20)9-19-16(21)13-14(18)11(17)8-12(22-2)15(13)23-3/h8,10H,4-7,9,18H2,1-3H3,(H,19,21) |
| InChIKey | JVZAYLSEXNKOFB-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.29 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|