C17H23BrN2O4 — CID 13493835
[6-bromo-2-[(1-ethylpyrrolidin-2-yl)methylcarbamoyl]-3-methoxyphenyl] acetate (PubChem CID 13493835) has the molecular formula C17H23BrN2O4 and a molecular weight of 399.29 g/mol. Its IUPAC name is [6-bromo-2-[(1-ethylpyrrolidin-2-yl)methylcarbamoyl]-3-methoxyphenyl] acetate.
| Compound Name | [6-bromo-2-[(1-ethylpyrrolidin-2-yl)methylcarbamoyl]-3-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 13493835 |
| Molecular Formula | C17H23BrN2O4 |
| Molecular Weight | 399.29 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | [6-bromo-2-[(1-ethylpyrrolidin-2-yl)methylcarbamoyl]-3-methoxyphenyl] acetate |
| SMILES | CCN1CCCC1CNC(=O)c1c(OC)ccc(Br)c1OC(C)=O |
| InChI | InChI=1S/C17H23BrN2O4/c1-4-20-9-5-6-12(20)10-19-17(22)15-14(23-3)8-7-13(18)16(15)24-11(2)21/h7-8,12H,4-6,9-10H2,1-3H3,(H,19,22) |
| InChIKey | JHILJNVWNUBBMS-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.29 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|