C12H9ClF3NO2 — CID 107622842
6-chloro-7-methoxy-3-methyl-2-(trifluoromethyl)-1H-quinolin-4-one (PubChem CID 107622842) has the molecular formula C12H9ClF3NO2 and a molecular weight of 291.66 g/mol. Its IUPAC name is 6-chloro-7-methoxy-3-methyl-2-(trifluoromethyl)-1H-quinolin-4-one.
| Compound Name | 6-chloro-7-methoxy-3-methyl-2-(trifluoromethyl)-1H-quinolin-4-one |
|---|---|
| PubChem CID | 107622842 |
| Molecular Formula | C12H9ClF3NO2 |
| Molecular Weight | 291.66 g/mol |
| Exact Mass | 291.03 |
| IUPAC Name | 6-chloro-7-methoxy-3-methyl-2-(trifluoromethyl)-1H-quinolin-4-one |
| SMILES | COc1cc2[nH]c(C(F)(F)F)c(C)c(=O)c2cc1Cl |
| InChI | InChI=1S/C12H9ClF3NO2/c1-5-10(18)6-3-7(13)9(19-2)4-8(6)17-11(5)12(14,15)16/h3-4H,1-2H3,(H,17,18) |
| InChIKey | DUEOFKGNCSAIBP-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.66 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |