C19H16Cl2N2O3 — CID 22431028
5-chloro-3-[2-(5-chloro-N,2-dimethylanilino)-2-oxoethyl]-1H-indole-2-carboxylic acid (PubChem CID 22431028) has the molecular formula C19H16Cl2N2O3 and a molecular weight of 391.25 g/mol. Its IUPAC name is 5-chloro-3-[2-(5-chloro-N,2-dimethylanilino)-2-oxoethyl]-1H-indole-2-carboxylic acid.
| Compound Name | 5-chloro-3-[2-(5-chloro-N,2-dimethylanilino)-2-oxoethyl]-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 22431028 |
| Molecular Formula | C19H16Cl2N2O3 |
| Molecular Weight | 391.25 g/mol |
| Exact Mass | 390.05 |
| IUPAC Name | 5-chloro-3-[2-(5-chloro-N,2-dimethylanilino)-2-oxoethyl]-1H-indole-2-carboxylic acid |
| SMILES | Cc1ccc(Cl)cc1N(C)C(=O)Cc1c(C(=O)O)[nH]c2ccc(Cl)cc12 |
| InChI | InChI=1S/C19H16Cl2N2O3/c1-10-3-4-12(21)8-16(10)23(2)17(24)9-14-13-7-11(20)5-6-15(13)22-18(14)19(25)26/h3-8,22H,9H2,1-2H3,(H,25,26) |
| InChIKey | UGLXALBTPIKGFM-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 73.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.25 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|