C21H21ClN2O3 — CID 6621510
5-chloro-3-[2-(N-ethyl-3,4-dimethylanilino)-2-oxoethyl]-1H-indole-2-carboxylic acid (PubChem CID 6621510) has the molecular formula C21H21ClN2O3 and a molecular weight of 384.86 g/mol. Its IUPAC name is 5-chloro-3-[2-(N-ethyl-3,4-dimethylanilino)-2-oxoethyl]-1H-indole-2-carboxylic acid.
| Compound Name | 5-chloro-3-[2-(N-ethyl-3,4-dimethylanilino)-2-oxoethyl]-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 6621510 |
| Molecular Formula | C21H21ClN2O3 |
| Molecular Weight | 384.86 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | 5-chloro-3-[2-(N-ethyl-3,4-dimethylanilino)-2-oxoethyl]-1H-indole-2-carboxylic acid |
| SMILES | CCN(C(=O)Cc1c(C(=O)O)[nH]c2ccc(Cl)cc12)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C21H21ClN2O3/c1-4-24(15-7-5-12(2)13(3)9-15)19(25)11-17-16-10-14(22)6-8-18(16)23-20(17)21(26)27/h5-10,23H,4,11H2,1-3H3,(H,26,27) |
| InChIKey | WMKYFDZROPBFEV-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 73.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.86 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|