C20H17ClN2O3 — CID 15997215
5-chloro-3-[2-oxo-2-(N-prop-2-enylanilino)ethyl]-1H-indole-2-carboxylic acid (PubChem CID 15997215) has the molecular formula C20H17ClN2O3 and a molecular weight of 368.82 g/mol. Its IUPAC name is 5-chloro-3-[2-oxo-2-(N-prop-2-enylanilino)ethyl]-1H-indole-2-carboxylic acid.
| Compound Name | 5-chloro-3-[2-oxo-2-(N-prop-2-enylanilino)ethyl]-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 15997215 |
| Molecular Formula | C20H17ClN2O3 |
| Molecular Weight | 368.82 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | 5-chloro-3-[2-oxo-2-(N-prop-2-enylanilino)ethyl]-1H-indole-2-carboxylic acid |
| SMILES | C=CCN(C(=O)Cc1c(C(=O)O)[nH]c2ccc(Cl)cc12)c1ccccc1 |
| InChI | InChI=1S/C20H17ClN2O3/c1-2-10-23(14-6-4-3-5-7-14)18(24)12-16-15-11-13(21)8-9-17(15)22-19(16)20(25)26/h2-9,11,22H,1,10,12H2,(H,25,26) |
| InChIKey | YAQOBABWTJDDHU-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 73.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.82 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|