5-methyl-3-(2,2,2-trifluoroacetyl)-1H-indole-2-carboxylic acid

C12H8F3NO3 — CID 84641540

IUPAC5-methyl-3-(2,2,2-trifluoroacetyl)-1H-indole-2-carboxylic acid
SMILESCc1ccc2[nH]c(C(=O)O)c(C(=O)C(F)(F)F)c2c1
InChIInChI=1S/C12H8F3NO3/c1-5-2-3-7-6(4-5)8(9(16-7)11(18)19)10(17)12(13,14)15/h2-4,16H,1H3,(H,18,19)
InChIKeyYYNIEMNWPCFQFA-UHFFFAOYSA-N
MW271.19 g/mol
LogP2.92
Rot. Bonds2

About 5-methyl-3-(2,2,2-trifluoroacetyl)-1H-indole-2-carboxylic acid

5-methyl-3-(2,2,2-trifluoroacetyl)-1H-indole-2-carboxylic acid (PubChem CID 84641540) has the molecular formula C12H8F3NO3 and a molecular weight of 271.19 g/mol. Its IUPAC name is 5-methyl-3-(2,2,2-trifluoroacetyl)-1H-indole-2-carboxylic acid.

Molecular Properties

Compound Name5-methyl-3-(2,2,2-trifluoroacetyl)-1H-indole-2-carboxylic acid
PubChem CID84641540
Molecular FormulaC12H8F3NO3
Molecular Weight271.19 g/mol
Exact Mass271.05
IUPAC Name5-methyl-3-(2,2,2-trifluoroacetyl)-1H-indole-2-carboxylic acid
SMILESCc1ccc2[nH]c(C(=O)O)c(C(=O)C(F)(F)F)c2c1
InChIInChI=1S/C12H8F3NO3/c1-5-2-3-7-6(4-5)8(9(16-7)11(18)19)10(17)12(13,14)15/h2-4,16H,1H3,(H,18,19)
InChIKeyYYNIEMNWPCFQFA-UHFFFAOYSA-N
XLogP2.92
TPSA70.16 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500271.19
LogP ≤ 52.92
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 5-methyl-3-(2,2,2-trifluoroacetyl)-1H-indole-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-methyl-3-(2,2,2-trifluoroacetyl)-1H-indole-2-carboxylic acid?
The IUPAC name of 5-methyl-3-(2,2,2-trifluoroacetyl)-1H-indole-2-carboxylic acid (CID 84641540) is 5-methyl-3-(2,2,2-trifluoroacetyl)-1H-indole-2-carboxylic acid.
What is the SMILES notation for 5-methyl-3-(2,2,2-trifluoroacetyl)-1H-indole-2-carboxylic acid?
The canonical SMILES for 5-methyl-3-(2,2,2-trifluoroacetyl)-1H-indole-2-carboxylic acid is Cc1ccc2[nH]c(C(=O)O)c(C(=O)C(F)(F)F)c2c1.
What is the InChIKey of 5-methyl-3-(2,2,2-trifluoroacetyl)-1H-indole-2-carboxylic acid?
The InChIKey is YYNIEMNWPCFQFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8F3NO3/c1-5-2-3-7-6(4-5)8(9(16-7)11(18)19)10(17)12(13,14)15/h2-4,16H,1H3,(H,18,19).
What are the key properties of 5-methyl-3-(2,2,2-trifluoroacetyl)-1H-indole-2-carboxylic acid?
5-methyl-3-(2,2,2-trifluoroacetyl)-1H-indole-2-carboxylic acid has a molecular weight of 271.19 g/mol, XLogP of 2.92, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-3-(2,2,2-trifluoroacetyl)-1H-indole-2-carboxylic acid is sourced from PubChem (CID 84641540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).