C12H8F3NO3 — CID 84641540
5-methyl-3-(2,2,2-trifluoroacetyl)-1H-indole-2-carboxylic acid (PubChem CID 84641540) has the molecular formula C12H8F3NO3 and a molecular weight of 271.19 g/mol. Its IUPAC name is 5-methyl-3-(2,2,2-trifluoroacetyl)-1H-indole-2-carboxylic acid.
| Compound Name | 5-methyl-3-(2,2,2-trifluoroacetyl)-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 84641540 |
| Molecular Formula | C12H8F3NO3 |
| Molecular Weight | 271.19 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | 5-methyl-3-(2,2,2-trifluoroacetyl)-1H-indole-2-carboxylic acid |
| SMILES | Cc1ccc2[nH]c(C(=O)O)c(C(=O)C(F)(F)F)c2c1 |
| InChI | InChI=1S/C12H8F3NO3/c1-5-2-3-7-6(4-5)8(9(16-7)11(18)19)10(17)12(13,14)15/h2-4,16H,1H3,(H,18,19) |
| InChIKey | YYNIEMNWPCFQFA-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 70.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.19 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |