C18H12F3N2O4- — CID 18542197
2-[2-(4-methylpyridine-2-carbonyl)-5-(trifluoromethoxy)-1H-indol-3-yl]acetate (PubChem CID 18542197) has the molecular formula C18H12F3N2O4- and a molecular weight of 377.30 g/mol. Its IUPAC name is 2-[2-(4-methylpyridine-2-carbonyl)-5-(trifluoromethoxy)-1H-indol-3-yl]acetate.
| Compound Name | 2-[2-(4-methylpyridine-2-carbonyl)-5-(trifluoromethoxy)-1H-indol-3-yl]acetate |
|---|---|
| PubChem CID | 18542197 |
| Molecular Formula | C18H12F3N2O4- |
| Molecular Weight | 377.30 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | 2-[2-(4-methylpyridine-2-carbonyl)-5-(trifluoromethoxy)-1H-indol-3-yl]acetate |
| SMILES | Cc1ccnc(C(=O)c2[nH]c3ccc(OC(F)(F)F)cc3c2CC(=O)[O-])c1 |
| InChI | InChI=1S/C18H13F3N2O4/c1-9-4-5-22-14(6-9)17(26)16-12(8-15(24)25)11-7-10(27-18(19,20)21)2-3-13(11)23-16/h2-7,23H,8H2,1H3,(H,24,25)/p-1 |
| InChIKey | XAVZMVCQMPSHMP-UHFFFAOYSA-M |
| XLogP | 2.29 |
| TPSA | 95.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.30 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|