C30H31F3N2O7S2 — CID 153422648
ethyl 2-[3-[[3-[1,1-difluoro-2-(4-methylphenyl)sulfonyloxyethyl]-4-(methylsulfamoyl)phenyl]methyl]-5-fluoro-2-methylindol-1-yl]acetate (PubChem CID 153422648) has the molecular formula C30H31F3N2O7S2 and a molecular weight of 652.71 g/mol. Its IUPAC name is ethyl 2-[3-[[3-[1,1-difluoro-2-(4-methylphenyl)sulfonyloxyethyl]-4-(methylsulfamoyl)phenyl]methyl]-5-fluoro-2-methylindol-1-yl]acetate.
| Compound Name | ethyl 2-[3-[[3-[1,1-difluoro-2-(4-methylphenyl)sulfonyloxyethyl]-4-(methylsulfamoyl)phenyl]methyl]-5-fluoro-2-methylindol-1-yl]acetate |
|---|---|
| PubChem CID | 153422648 |
| Molecular Formula | C30H31F3N2O7S2 |
| Molecular Weight | 652.71 g/mol |
| Exact Mass | 652.15 |
| IUPAC Name | ethyl 2-[3-[[3-[1,1-difluoro-2-(4-methylphenyl)sulfonyloxyethyl]-4-(methylsulfamoyl)phenyl]methyl]-5-fluoro-2-methylindol-1-yl]acetate |
| SMILES | CCOC(=O)Cn1c(C)c(Cc2ccc(S(=O)(=O)NC)c(C(F)(F)COS(=O)(=O)c3ccc(C)cc3)c2)c2cc(F)ccc21 |
| InChI | InChI=1S/C30H31F3N2O7S2/c1-5-41-29(36)17-35-20(3)24(25-16-22(31)9-12-27(25)35)14-21-8-13-28(43(37,38)34-4)26(15-21)30(32,33)18-42-44(39,40)23-10-6-19(2)7-11-23/h6-13,15-16,34H,5,14,17-18H2,1-4H3 |
| InChIKey | WRSJTVJASRBWLS-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.71 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|