C25H22F2N2O3 — CID 67150812
methyl 2-[5-fluoro-3-[[1-[(4-fluorophenyl)methyl]-6-oxo-3-pyridinyl]methyl]-2-methylindol-1-yl]acetate (PubChem CID 67150812) has the molecular formula C25H22F2N2O3 and a molecular weight of 436.46 g/mol. Its IUPAC name is methyl 2-[5-fluoro-3-[[1-[(4-fluorophenyl)methyl]-6-oxo-3-pyridinyl]methyl]-2-methylindol-1-yl]acetate.
| Compound Name | methyl 2-[5-fluoro-3-[[1-[(4-fluorophenyl)methyl]-6-oxo-3-pyridinyl]methyl]-2-methylindol-1-yl]acetate |
|---|---|
| PubChem CID | 67150812 |
| Molecular Formula | C25H22F2N2O3 |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | methyl 2-[5-fluoro-3-[[1-[(4-fluorophenyl)methyl]-6-oxo-3-pyridinyl]methyl]-2-methylindol-1-yl]acetate |
| SMILES | COC(=O)Cn1c(C)c(Cc2ccc(=O)n(Cc3ccc(F)cc3)c2)c2cc(F)ccc21 |
| InChI | InChI=1S/C25H22F2N2O3/c1-16-21(22-12-20(27)8-9-23(22)29(16)15-25(31)32-2)11-18-5-10-24(30)28(14-18)13-17-3-6-19(26)7-4-17/h3-10,12,14H,11,13,15H2,1-2H3 |
| InChIKey | FIYKFFLXCGFQIK-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 53.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|