C24H21FN2O3 — CID 67150992
methyl 2-[3-(1-benzyl-6-oxo-3-pyridinyl)-5-fluoro-2-methylindol-1-yl]acetate (PubChem CID 67150992) has the molecular formula C24H21FN2O3 and a molecular weight of 404.44 g/mol. Its IUPAC name is methyl 2-[3-(1-benzyl-6-oxo-3-pyridinyl)-5-fluoro-2-methylindol-1-yl]acetate.
| Compound Name | methyl 2-[3-(1-benzyl-6-oxo-3-pyridinyl)-5-fluoro-2-methylindol-1-yl]acetate |
|---|---|
| PubChem CID | 67150992 |
| Molecular Formula | C24H21FN2O3 |
| Molecular Weight | 404.44 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | methyl 2-[3-(1-benzyl-6-oxo-3-pyridinyl)-5-fluoro-2-methylindol-1-yl]acetate |
| SMILES | COC(=O)Cn1c(C)c(-c2ccc(=O)n(Cc3ccccc3)c2)c2cc(F)ccc21 |
| InChI | InChI=1S/C24H21FN2O3/c1-16-24(20-12-19(25)9-10-21(20)27(16)15-23(29)30-2)18-8-11-22(28)26(14-18)13-17-6-4-3-5-7-17/h3-12,14H,13,15H2,1-2H3 |
| InChIKey | MONNWUNFBXJTRA-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 53.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.44 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |