C25H21ClFNO4S — CID 67043779
methyl 2-[3-[[2-(benzenesulfonyl)-4-chlorophenyl]methyl]-5-fluoro-2-methylindol-1-yl]acetate (PubChem CID 67043779) has the molecular formula C25H21ClFNO4S and a molecular weight of 485.96 g/mol. Its IUPAC name is methyl 2-[3-[[2-(benzenesulfonyl)-4-chlorophenyl]methyl]-5-fluoro-2-methylindol-1-yl]acetate.
| Compound Name | methyl 2-[3-[[2-(benzenesulfonyl)-4-chlorophenyl]methyl]-5-fluoro-2-methylindol-1-yl]acetate |
|---|---|
| PubChem CID | 67043779 |
| Molecular Formula | C25H21ClFNO4S |
| Molecular Weight | 485.96 g/mol |
| Exact Mass | 485.09 |
| IUPAC Name | methyl 2-[3-[[2-(benzenesulfonyl)-4-chlorophenyl]methyl]-5-fluoro-2-methylindol-1-yl]acetate |
| SMILES | COC(=O)Cn1c(C)c(Cc2ccc(Cl)cc2S(=O)(=O)c2ccccc2)c2cc(F)ccc21 |
| InChI | InChI=1S/C25H21ClFNO4S/c1-16-21(22-14-19(27)10-11-23(22)28(16)15-25(29)32-2)12-17-8-9-18(26)13-24(17)33(30,31)20-6-4-3-5-7-20/h3-11,13-14H,12,15H2,1-2H3 |
| InChIKey | KOAMDCSHKZSSFK-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 65.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.96 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|