C44H40F2N6O8S2 — CID 159576866
2-[3-[[5-(benzenesulfonyl)-1-methylimidazol-4-yl]methyl]-5-fluoro-2-methylindol-1-yl]acetic acid (PubChem CID 159576866) has the molecular formula C44H40F2N6O8S2 and a molecular weight of 882.97 g/mol. Its IUPAC name is 2-[3-[[5-(benzenesulfonyl)-1-methylimidazol-4-yl]methyl]-5-fluoro-2-methylindol-1-yl]acetic acid.
| Compound Name | 2-[3-[[5-(benzenesulfonyl)-1-methylimidazol-4-yl]methyl]-5-fluoro-2-methylindol-1-yl]acetic acid |
|---|---|
| PubChem CID | 159576866 |
| Molecular Formula | C44H40F2N6O8S2 |
| Molecular Weight | 882.97 g/mol |
| Exact Mass | 882.23 |
| IUPAC Name | 2-[3-[[5-(benzenesulfonyl)-1-methylimidazol-4-yl]methyl]-5-fluoro-2-methylindol-1-yl]acetic acid |
| SMILES | Cc1c(Cc2ncn(C)c2S(=O)(=O)c2ccccc2)c2cc(F)ccc2n1CC(=O)O.Cc1c(Cc2ncn(C)c2S(=O)(=O)c2ccccc2)c2cc(F)ccc2n1CC(=O)O |
| InChI | InChI=1S/2C22H20FN3O4S/c2*1-14-17(18-10-15(23)8-9-20(18)26(14)12-21(27)28)11-19-22(25(2)13-24-19)31(29,30)16-6-4-3-5-7-16/h2*3-10,13H,11-12H2,1-2H3,(H,27,28) |
| InChIKey | MINBZPLPDBTCMI-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 188.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 882.97 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|