C21H16ClFN2O4S2 — CID 42645098
2-[3-[(5-chloro-3-pyridin-2-ylsulfonylthiophen-2-yl)methyl]-5-fluoro-2-methylindol-1-yl]acetic acid (PubChem CID 42645098) has the molecular formula C21H16ClFN2O4S2 and a molecular weight of 478.95 g/mol. Its IUPAC name is 2-[3-[(5-chloro-3-pyridin-2-ylsulfonylthiophen-2-yl)methyl]-5-fluoro-2-methylindol-1-yl]acetic acid.
| Compound Name | 2-[3-[(5-chloro-3-pyridin-2-ylsulfonylthiophen-2-yl)methyl]-5-fluoro-2-methylindol-1-yl]acetic acid |
|---|---|
| PubChem CID | 42645098 |
| Molecular Formula | C21H16ClFN2O4S2 |
| Molecular Weight | 478.95 g/mol |
| Exact Mass | 478.02 |
| IUPAC Name | 2-[3-[(5-chloro-3-pyridin-2-ylsulfonylthiophen-2-yl)methyl]-5-fluoro-2-methylindol-1-yl]acetic acid |
| SMILES | Cc1c(Cc2sc(Cl)cc2S(=O)(=O)c2ccccn2)c2cc(F)ccc2n1CC(=O)O |
| InChI | InChI=1S/C21H16ClFN2O4S2/c1-12-14(15-8-13(23)5-6-16(15)25(12)11-21(26)27)9-17-18(10-19(22)30-17)31(28,29)20-4-2-3-7-24-20/h2-8,10H,9,11H2,1H3,(H,26,27) |
| InChIKey | VBFMRMAXDIETCL-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.95 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|