C20H18FN3O2S — CID 138663255
2-[5-fluoro-2-methyl-3-[(3-methyl-2H-1,2,4-benzothiadiazin-6-yl)methyl]indol-1-yl]acetic acid (PubChem CID 138663255) has the molecular formula C20H18FN3O2S and a molecular weight of 383.45 g/mol. Its IUPAC name is 2-[5-fluoro-2-methyl-3-[(3-methyl-2H-1,2,4-benzothiadiazin-6-yl)methyl]indol-1-yl]acetic acid.
| Compound Name | 2-[5-fluoro-2-methyl-3-[(3-methyl-2H-1,2,4-benzothiadiazin-6-yl)methyl]indol-1-yl]acetic acid |
|---|---|
| PubChem CID | 138663255 |
| Molecular Formula | C20H18FN3O2S |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | 2-[5-fluoro-2-methyl-3-[(3-methyl-2H-1,2,4-benzothiadiazin-6-yl)methyl]indol-1-yl]acetic acid |
| SMILES | CC1=Nc2cc(Cc3c(C)n(CC(=O)O)c4ccc(F)cc34)ccc2SN1 |
| InChI | InChI=1S/C20H18FN3O2S/c1-11-15(7-13-3-6-19-17(8-13)22-12(2)23-27-19)16-9-14(21)4-5-18(16)24(11)10-20(25)26/h3-6,8-9H,7,10H2,1-2H3,(H,22,23)(H,25,26) |
| InChIKey | UERZLNLTJKADCI-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 66.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|