C22H24FNO2S — CID 67159539
2-[3-[(4-tert-butylsulfanylphenyl)methyl]-5-fluoro-2-methylindol-1-yl]acetic acid (PubChem CID 67159539) has the molecular formula C22H24FNO2S and a molecular weight of 385.50 g/mol. Its IUPAC name is 2-[3-[(4-tert-butylsulfanylphenyl)methyl]-5-fluoro-2-methylindol-1-yl]acetic acid.
| Compound Name | 2-[3-[(4-tert-butylsulfanylphenyl)methyl]-5-fluoro-2-methylindol-1-yl]acetic acid |
|---|---|
| PubChem CID | 67159539 |
| Molecular Formula | C22H24FNO2S |
| Molecular Weight | 385.50 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | 2-[3-[(4-tert-butylsulfanylphenyl)methyl]-5-fluoro-2-methylindol-1-yl]acetic acid |
| SMILES | Cc1c(Cc2ccc(SC(C)(C)C)cc2)c2cc(F)ccc2n1CC(=O)O |
| InChI | InChI=1S/C22H24FNO2S/c1-14-18(11-15-5-8-17(9-6-15)27-22(2,3)4)19-12-16(23)7-10-20(19)24(14)13-21(25)26/h5-10,12H,11,13H2,1-4H3,(H,25,26) |
| InChIKey | SKBKQJHNXXMPON-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.50 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|