C24H18F3NO3 — CID 67159574
2-[3-[[2-(3,4-difluorophenoxy)phenyl]methyl]-5-fluoro-2-methylindol-1-yl]acetic acid (PubChem CID 67159574) has the molecular formula C24H18F3NO3 and a molecular weight of 425.41 g/mol. Its IUPAC name is 2-[3-[[2-(3,4-difluorophenoxy)phenyl]methyl]-5-fluoro-2-methylindol-1-yl]acetic acid.
| Compound Name | 2-[3-[[2-(3,4-difluorophenoxy)phenyl]methyl]-5-fluoro-2-methylindol-1-yl]acetic acid |
|---|---|
| PubChem CID | 67159574 |
| Molecular Formula | C24H18F3NO3 |
| Molecular Weight | 425.41 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | 2-[3-[[2-(3,4-difluorophenoxy)phenyl]methyl]-5-fluoro-2-methylindol-1-yl]acetic acid |
| SMILES | Cc1c(Cc2ccccc2Oc2ccc(F)c(F)c2)c2cc(F)ccc2n1CC(=O)O |
| InChI | InChI=1S/C24H18F3NO3/c1-14-18(19-11-16(25)6-9-22(19)28(14)13-24(29)30)10-15-4-2-3-5-23(15)31-17-7-8-20(26)21(27)12-17/h2-9,11-12H,10,13H2,1H3,(H,29,30) |
| InChIKey | BQDOCSADMAOQIR-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.41 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|