C19H16FN3O2 — CID 67160144
2-[5-fluoro-3-(imidazo[1,2-a]pyridin-2-ylmethyl)-2-methylindol-1-yl]acetic acid (PubChem CID 67160144) has the molecular formula C19H16FN3O2 and a molecular weight of 337.35 g/mol. Its IUPAC name is 2-[5-fluoro-3-(imidazo[1,2-a]pyridin-2-ylmethyl)-2-methylindol-1-yl]acetic acid.
| Compound Name | 2-[5-fluoro-3-(imidazo[1,2-a]pyridin-2-ylmethyl)-2-methylindol-1-yl]acetic acid |
|---|---|
| PubChem CID | 67160144 |
| Molecular Formula | C19H16FN3O2 |
| Molecular Weight | 337.35 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 2-[5-fluoro-3-(imidazo[1,2-a]pyridin-2-ylmethyl)-2-methylindol-1-yl]acetic acid |
| SMILES | Cc1c(Cc2cn3ccccc3n2)c2cc(F)ccc2n1CC(=O)O |
| InChI | InChI=1S/C19H16FN3O2/c1-12-15(9-14-10-22-7-3-2-4-18(22)21-14)16-8-13(20)5-6-17(16)23(12)11-19(24)25/h2-8,10H,9,11H2,1H3,(H,24,25) |
| InChIKey | CJKAKAXEOWFTDV-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 59.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.35 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|