C22H24FNO4S — CID 67159978
2-[3-[(2-butan-2-ylsulfonylphenyl)methyl]-5-fluoro-2-methylindol-1-yl]acetic acid (PubChem CID 67159978) has the molecular formula C22H24FNO4S and a molecular weight of 417.50 g/mol. Its IUPAC name is 2-[3-[(2-butan-2-ylsulfonylphenyl)methyl]-5-fluoro-2-methylindol-1-yl]acetic acid.
| Compound Name | 2-[3-[(2-butan-2-ylsulfonylphenyl)methyl]-5-fluoro-2-methylindol-1-yl]acetic acid |
|---|---|
| PubChem CID | 67159978 |
| Molecular Formula | C22H24FNO4S |
| Molecular Weight | 417.50 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | 2-[3-[(2-butan-2-ylsulfonylphenyl)methyl]-5-fluoro-2-methylindol-1-yl]acetic acid |
| SMILES | CCC(C)S(=O)(=O)c1ccccc1Cc1c(C)n(CC(=O)O)c2ccc(F)cc12 |
| InChI | InChI=1S/C22H24FNO4S/c1-4-14(2)29(27,28)21-8-6-5-7-16(21)11-18-15(3)24(13-22(25)26)20-10-9-17(23)12-19(18)20/h5-10,12,14H,4,11,13H2,1-3H3,(H,25,26) |
| InChIKey | AVMIPJYSHKQHCN-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 76.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.50 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|