C31H30FN3O4S — CID 158365819
aniline;methyl 2-[5-fluoro-2-methyl-3-[[2-(phenylsulfamoyl)phenyl]methyl]indol-1-yl]acetate (PubChem CID 158365819) has the molecular formula C31H30FN3O4S and a molecular weight of 559.66 g/mol. Its IUPAC name is aniline;methyl 2-[5-fluoro-2-methyl-3-[[2-(phenylsulfamoyl)phenyl]methyl]indol-1-yl]acetate.
| Compound Name | aniline;methyl 2-[5-fluoro-2-methyl-3-[[2-(phenylsulfamoyl)phenyl]methyl]indol-1-yl]acetate |
|---|---|
| PubChem CID | 158365819 |
| Molecular Formula | C31H30FN3O4S |
| Molecular Weight | 559.66 g/mol |
| Exact Mass | 559.19 |
| IUPAC Name | aniline;methyl 2-[5-fluoro-2-methyl-3-[[2-(phenylsulfamoyl)phenyl]methyl]indol-1-yl]acetate |
| SMILES | COC(=O)Cn1c(C)c(Cc2ccccc2S(=O)(=O)Nc2ccccc2)c2cc(F)ccc21.Nc1ccccc1 |
| InChI | InChI=1S/C25H23FN2O4S.C6H7N/c1-17-21(22-15-19(26)12-13-23(22)28(17)16-25(29)32-2)14-18-8-6-7-11-24(18)33(30,31)27-20-9-4-3-5-10-20;7-6-4-2-1-3-5-6/h3-13,15,27H,14,16H2,1-2H3;1-5H,7H2 |
| InChIKey | GTZXIOFZACRYJS-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 103.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.66 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|