C18H17FN2O5S — CID 11417943
2-[5-fluoro-3-[(2-methoxyphenyl)sulfamoyl]-2-methylindol-1-yl]acetic acid (PubChem CID 11417943) has the molecular formula C18H17FN2O5S and a molecular weight of 392.41 g/mol. Its IUPAC name is 2-[5-fluoro-3-[(2-methoxyphenyl)sulfamoyl]-2-methylindol-1-yl]acetic acid.
| Compound Name | 2-[5-fluoro-3-[(2-methoxyphenyl)sulfamoyl]-2-methylindol-1-yl]acetic acid |
|---|---|
| PubChem CID | 11417943 |
| Molecular Formula | C18H17FN2O5S |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | 2-[5-fluoro-3-[(2-methoxyphenyl)sulfamoyl]-2-methylindol-1-yl]acetic acid |
| SMILES | COc1ccccc1NS(=O)(=O)c1c(C)n(CC(=O)O)c2ccc(F)cc12 |
| InChI | InChI=1S/C18H17FN2O5S/c1-11-18(27(24,25)20-14-5-3-4-6-16(14)26-2)13-9-12(19)7-8-15(13)21(11)10-17(22)23/h3-9,20H,10H2,1-2H3,(H,22,23) |
| InChIKey | YBKSZTQAAOYYOH-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 97.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |