C18H17ClN2O7S2 — CID 174739753
2-[3-(2-chlorophenoxy)sulfonyl-2-methyl-5-(sulfinomethylamino)indol-1-yl]acetic acid (PubChem CID 174739753) has the molecular formula C18H17ClN2O7S2 and a molecular weight of 472.93 g/mol. Its IUPAC name is 2-[3-(2-chlorophenoxy)sulfonyl-2-methyl-5-(sulfinomethylamino)indol-1-yl]acetic acid.
| Compound Name | 2-[3-(2-chlorophenoxy)sulfonyl-2-methyl-5-(sulfinomethylamino)indol-1-yl]acetic acid |
|---|---|
| PubChem CID | 174739753 |
| Molecular Formula | C18H17ClN2O7S2 |
| Molecular Weight | 472.93 g/mol |
| Exact Mass | 472.02 |
| IUPAC Name | 2-[3-(2-chlorophenoxy)sulfonyl-2-methyl-5-(sulfinomethylamino)indol-1-yl]acetic acid |
| SMILES | Cc1c(S(=O)(=O)Oc2ccccc2Cl)c2cc(NCS(=O)O)ccc2n1CC(=O)O |
| InChI | InChI=1S/C18H17ClN2O7S2/c1-11-18(30(26,27)28-16-5-3-2-4-14(16)19)13-8-12(20-10-29(24)25)6-7-15(13)21(11)9-17(22)23/h2-8,20H,9-10H2,1H3,(H,22,23)(H,24,25) |
| InChIKey | VSNBQVZQGMTKPB-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 134.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.93 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|