C18H16ClNO4S — CID 10407275
2-[3-(4-chlorophenyl)sulfonyl-2,5-dimethylindol-1-yl]acetic acid (PubChem CID 10407275) has the molecular formula C18H16ClNO4S and a molecular weight of 377.85 g/mol. Its IUPAC name is 2-[3-(4-chlorophenyl)sulfonyl-2,5-dimethylindol-1-yl]acetic acid.
| Compound Name | 2-[3-(4-chlorophenyl)sulfonyl-2,5-dimethylindol-1-yl]acetic acid |
|---|---|
| PubChem CID | 10407275 |
| Molecular Formula | C18H16ClNO4S |
| Molecular Weight | 377.85 g/mol |
| Exact Mass | 377.05 |
| IUPAC Name | 2-[3-(4-chlorophenyl)sulfonyl-2,5-dimethylindol-1-yl]acetic acid |
| SMILES | Cc1ccc2c(c1)c(S(=O)(=O)c1ccc(Cl)cc1)c(C)n2CC(=O)O |
| InChI | InChI=1S/C18H16ClNO4S/c1-11-3-8-16-15(9-11)18(12(2)20(16)10-17(21)22)25(23,24)14-6-4-13(19)5-7-14/h3-9H,10H2,1-2H3,(H,21,22) |
| InChIKey | SFZUWPLSLIVZMS-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 76.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.85 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |