C18H13ClF3NO4 — CID 68616764
2-[3-(4-chlorophenoxy)-2-methyl-5-(trifluoromethoxy)indol-1-yl]acetic acid (PubChem CID 68616764) has the molecular formula C18H13ClF3NO4 and a molecular weight of 399.75 g/mol. Its IUPAC name is 2-[3-(4-chlorophenoxy)-2-methyl-5-(trifluoromethoxy)indol-1-yl]acetic acid.
| Compound Name | 2-[3-(4-chlorophenoxy)-2-methyl-5-(trifluoromethoxy)indol-1-yl]acetic acid |
|---|---|
| PubChem CID | 68616764 |
| Molecular Formula | C18H13ClF3NO4 |
| Molecular Weight | 399.75 g/mol |
| Exact Mass | 399.05 |
| IUPAC Name | 2-[3-(4-chlorophenoxy)-2-methyl-5-(trifluoromethoxy)indol-1-yl]acetic acid |
| SMILES | Cc1c(Oc2ccc(Cl)cc2)c2cc(OC(F)(F)F)ccc2n1CC(=O)O |
| InChI | InChI=1S/C18H13ClF3NO4/c1-10-17(26-12-4-2-11(19)3-5-12)14-8-13(27-18(20,21)22)6-7-15(14)23(10)9-16(24)25/h2-8H,9H2,1H3,(H,24,25) |
| InChIKey | MFDTUBAKXWOCMS-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.75 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |