C19H17ClN2O6S — CID 174739544
2-[4-acetamido-3-(3-chlorophenoxy)sulfonyl-2-methylindol-1-yl]acetic acid (PubChem CID 174739544) has the molecular formula C19H17ClN2O6S and a molecular weight of 436.87 g/mol. Its IUPAC name is 2-[4-acetamido-3-(3-chlorophenoxy)sulfonyl-2-methylindol-1-yl]acetic acid.
| Compound Name | 2-[4-acetamido-3-(3-chlorophenoxy)sulfonyl-2-methylindol-1-yl]acetic acid |
|---|---|
| PubChem CID | 174739544 |
| Molecular Formula | C19H17ClN2O6S |
| Molecular Weight | 436.87 g/mol |
| Exact Mass | 436.05 |
| IUPAC Name | 2-[4-acetamido-3-(3-chlorophenoxy)sulfonyl-2-methylindol-1-yl]acetic acid |
| SMILES | CC(=O)Nc1cccc2c1c(S(=O)(=O)Oc1cccc(Cl)c1)c(C)n2CC(=O)O |
| InChI | InChI=1S/C19H17ClN2O6S/c1-11-19(29(26,27)28-14-6-3-5-13(20)9-14)18-15(21-12(2)23)7-4-8-16(18)22(11)10-17(24)25/h3-9H,10H2,1-2H3,(H,21,23)(H,24,25) |
| InChIKey | KTAMXJGVEPTCDV-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 114.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.87 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|