C24H21ClN2O2S — CID 141369830
2-[4-(benzylamino)-3-(4-chlorophenyl)sulfanyl-2-methylindol-1-yl]acetic acid (PubChem CID 141369830) has the molecular formula C24H21ClN2O2S and a molecular weight of 436.96 g/mol. Its IUPAC name is 2-[4-(benzylamino)-3-(4-chlorophenyl)sulfanyl-2-methylindol-1-yl]acetic acid.
| Compound Name | 2-[4-(benzylamino)-3-(4-chlorophenyl)sulfanyl-2-methylindol-1-yl]acetic acid |
|---|---|
| PubChem CID | 141369830 |
| Molecular Formula | C24H21ClN2O2S |
| Molecular Weight | 436.96 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | 2-[4-(benzylamino)-3-(4-chlorophenyl)sulfanyl-2-methylindol-1-yl]acetic acid |
| SMILES | Cc1c(Sc2ccc(Cl)cc2)c2c(NCc3ccccc3)cccc2n1CC(=O)O |
| InChI | InChI=1S/C24H21ClN2O2S/c1-16-24(30-19-12-10-18(25)11-13-19)23-20(26-14-17-6-3-2-4-7-17)8-5-9-21(23)27(16)15-22(28)29/h2-13,26H,14-15H2,1H3,(H,28,29) |
| InChIKey | ZQNVFONREIZFHZ-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.96 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |