C22H24ClN3O3S — CID 141261636
ethyl 2-[3-(4-chlorophenyl)sulfanyl-4-(ethylcarbamoylamino)-2-methylindol-1-yl]acetate (PubChem CID 141261636) has the molecular formula C22H24ClN3O3S and a molecular weight of 445.97 g/mol. Its IUPAC name is ethyl 2-[3-(4-chlorophenyl)sulfanyl-4-(ethylcarbamoylamino)-2-methylindol-1-yl]acetate.
| Compound Name | ethyl 2-[3-(4-chlorophenyl)sulfanyl-4-(ethylcarbamoylamino)-2-methylindol-1-yl]acetate |
|---|---|
| PubChem CID | 141261636 |
| Molecular Formula | C22H24ClN3O3S |
| Molecular Weight | 445.97 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | ethyl 2-[3-(4-chlorophenyl)sulfanyl-4-(ethylcarbamoylamino)-2-methylindol-1-yl]acetate |
| SMILES | CCNC(=O)Nc1cccc2c1c(Sc1ccc(Cl)cc1)c(C)n2CC(=O)OCC |
| InChI | InChI=1S/C22H24ClN3O3S/c1-4-24-22(28)25-17-7-6-8-18-20(17)21(30-16-11-9-15(23)10-12-16)14(3)26(18)13-19(27)29-5-2/h6-12H,4-5,13H2,1-3H3,(H2,24,25,28) |
| InChIKey | ZTNRWDRWKRAEHE-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.97 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |