C32H31ClN4O8S — CID 161232032
ethyl 2-[3-(4-chlorophenyl)sulfanyl-2-methyl-4-nitroindol-1-yl]acetate;ethyl 2-(2-methyl-4-nitroindol-1-yl)acetate (PubChem CID 161232032) has the molecular formula C32H31ClN4O8S and a molecular weight of 667.14 g/mol. Its IUPAC name is ethyl 2-[3-(4-chlorophenyl)sulfanyl-2-methyl-4-nitroindol-1-yl]acetate;ethyl 2-(2-methyl-4-nitroindol-1-yl)acetate.
| Compound Name | ethyl 2-[3-(4-chlorophenyl)sulfanyl-2-methyl-4-nitroindol-1-yl]acetate;ethyl 2-(2-methyl-4-nitroindol-1-yl)acetate |
|---|---|
| PubChem CID | 161232032 |
| Molecular Formula | C32H31ClN4O8S |
| Molecular Weight | 667.14 g/mol |
| Exact Mass | 666.16 |
| IUPAC Name | ethyl 2-[3-(4-chlorophenyl)sulfanyl-2-methyl-4-nitroindol-1-yl]acetate;ethyl 2-(2-methyl-4-nitroindol-1-yl)acetate |
| SMILES | CCOC(=O)Cn1c(C)c(Sc2ccc(Cl)cc2)c2c([N+](=O)[O-])cccc21.CCOC(=O)Cn1c(C)cc2c([N+](=O)[O-])cccc21 |
| InChI | InChI=1S/C19H17ClN2O4S.C13H14N2O4/c1-3-26-17(23)11-21-12(2)19(27-14-9-7-13(20)8-10-14)18-15(21)5-4-6-16(18)22(24)25;1-3-19-13(16)8-14-9(2)7-10-11(14)5-4-6-12(10)15(17)18/h4-10H,3,11H2,1-2H3;4-7H,3,8H2,1-2H3 |
| InChIKey | UYWLGJOVJDYGCU-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 148.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.14 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|