C23H21N3O4 — CID 86600927
ethyl 2-[2,5-dimethyl-3-(8-nitroquinolin-4-yl)indol-1-yl]acetate (PubChem CID 86600927) has the molecular formula C23H21N3O4 and a molecular weight of 403.44 g/mol. Its IUPAC name is ethyl 2-[2,5-dimethyl-3-(8-nitroquinolin-4-yl)indol-1-yl]acetate.
| Compound Name | ethyl 2-[2,5-dimethyl-3-(8-nitroquinolin-4-yl)indol-1-yl]acetate |
|---|---|
| PubChem CID | 86600927 |
| Molecular Formula | C23H21N3O4 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | ethyl 2-[2,5-dimethyl-3-(8-nitroquinolin-4-yl)indol-1-yl]acetate |
| SMILES | CCOC(=O)Cn1c(C)c(-c2ccnc3c([N+](=O)[O-])cccc23)c2cc(C)ccc21 |
| InChI | InChI=1S/C23H21N3O4/c1-4-30-21(27)13-25-15(3)22(18-12-14(2)8-9-19(18)25)16-10-11-24-23-17(16)6-5-7-20(23)26(28)29/h5-12H,4,13H2,1-3H3 |
| InChIKey | GDVXLDKXTVNZMU-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 87.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|