C19H19N2O8S2- — CID 174739741
[[1-(carboxymethyl)-3-(3-methoxyphenoxy)sulfonyl-2-methylindol-4-yl]amino]methanesulfinate (PubChem CID 174739741) has the molecular formula C19H19N2O8S2- and a molecular weight of 467.50 g/mol. Its IUPAC name is [[1-(carboxymethyl)-3-(3-methoxyphenoxy)sulfonyl-2-methylindol-4-yl]amino]methanesulfinate.
| Compound Name | [[1-(carboxymethyl)-3-(3-methoxyphenoxy)sulfonyl-2-methylindol-4-yl]amino]methanesulfinate |
|---|---|
| PubChem CID | 174739741 |
| Molecular Formula | C19H19N2O8S2- |
| Molecular Weight | 467.50 g/mol |
| Exact Mass | 467.06 |
| IUPAC Name | [[1-(carboxymethyl)-3-(3-methoxyphenoxy)sulfonyl-2-methylindol-4-yl]amino]methanesulfinate |
| SMILES | COc1cccc(OS(=O)(=O)c2c(C)n(CC(=O)O)c3cccc(NCS(=O)[O-])c23)c1 |
| InChI | InChI=1S/C19H20N2O8S2/c1-12-19(31(26,27)29-14-6-3-5-13(9-14)28-2)18-15(20-11-30(24)25)7-4-8-16(18)21(12)10-17(22)23/h3-9,20H,10-11H2,1-2H3,(H,22,23)(H,24,25)/p-1 |
| InChIKey | IVMHVMOMZHQJNA-UHFFFAOYSA-M |
| XLogP | 2.06 |
| TPSA | 146.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.50 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|