C19H20N2O9S3 — CID 174492751
2-[2-methyl-5-(sulfinomethylamino)-3-[3-(sulfinomethyl)phenoxy]sulfonylindol-1-yl]acetic acid (PubChem CID 174492751) has the molecular formula C19H20N2O9S3 and a molecular weight of 516.58 g/mol. Its IUPAC name is 2-[2-methyl-5-(sulfinomethylamino)-3-[3-(sulfinomethyl)phenoxy]sulfonylindol-1-yl]acetic acid.
| Compound Name | 2-[2-methyl-5-(sulfinomethylamino)-3-[3-(sulfinomethyl)phenoxy]sulfonylindol-1-yl]acetic acid |
|---|---|
| PubChem CID | 174492751 |
| Molecular Formula | C19H20N2O9S3 |
| Molecular Weight | 516.58 g/mol |
| Exact Mass | 516.03 |
| IUPAC Name | 2-[2-methyl-5-(sulfinomethylamino)-3-[3-(sulfinomethyl)phenoxy]sulfonylindol-1-yl]acetic acid |
| SMILES | Cc1c(S(=O)(=O)Oc2cccc(CS(=O)O)c2)c2cc(NCS(=O)O)ccc2n1CC(=O)O |
| InChI | InChI=1S/C19H20N2O9S3/c1-12-19(33(28,29)30-15-4-2-3-13(7-15)10-31(24)25)16-8-14(20-11-32(26)27)5-6-17(16)21(12)9-18(22)23/h2-8,20H,9-11H2,1H3,(H,22,23)(H,24,25)(H,26,27) |
| InChIKey | WZKVQTZSBHRXPC-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 172.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.58 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|